C8H15NO3S2 — CID 539482
2-acetamido-3-(propyldisulfanyl)propanoic acid (PubChem CID 539482) has the molecular formula C8H15NO3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-acetamido-3-(propyldisulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(propyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 539482 |
| Molecular Formula | C8H15NO3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-acetamido-3-(propyldisulfanyl)propanoic acid |
| SMILES | CCCSSCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO3S2/c1-3-4-13-14-5-7(8(11)12)9-6(2)10/h7H,3-5H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | IOXRPLPFAGFDFU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|