C19H37NO3S — CID 12019095
(2R)-2-acetamido-3-tetradecylsulfanylpropanoic acid (PubChem CID 12019095) has the molecular formula C19H37NO3S and a molecular weight of 359.58 g/mol. Its IUPAC name is (2R)-2-acetamido-3-tetradecylsulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-tetradecylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 12019095 |
| Molecular Formula | C19H37NO3S |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2R)-2-acetamido-3-tetradecylsulfanylpropanoic acid |
| SMILES | CCCCCCCCCCCCCCSC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C19H37NO3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-24-16-18(19(22)23)20-17(2)21/h18H,3-16H2,1-2H3,(H,20,21)(H,22,23)/t18-/m0/s1 |
| InChIKey | QQSQNYJFRXSVOS-SFHVURJKSA-N |
| XLogP | 5.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|