C21H40N4O6S — CID 134306581
3-[[(2R)-2-acetamido-3-octylsulfanylpropanoyl]-[3-(carboxyamino)propyl]amino]propylcarbamic acid (PubChem CID 134306581) has the molecular formula C21H40N4O6S and a molecular weight of 476.64 g/mol. Its IUPAC name is 3-[[(2R)-2-acetamido-3-octylsulfanylpropanoyl]-[3-(carboxyamino)propyl]amino]propylcarbamic acid.
| Compound Name | 3-[[(2R)-2-acetamido-3-octylsulfanylpropanoyl]-[3-(carboxyamino)propyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 134306581 |
| Molecular Formula | C21H40N4O6S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 3-[[(2R)-2-acetamido-3-octylsulfanylpropanoyl]-[3-(carboxyamino)propyl]amino]propylcarbamic acid |
| SMILES | CCCCCCCCSC[C@H](NC(C)=O)C(=O)N(CCCNC(=O)O)CCCNC(=O)O |
| InChI | InChI=1S/C21H40N4O6S/c1-3-4-5-6-7-8-15-32-16-18(24-17(2)26)19(27)25(13-9-11-22-20(28)29)14-10-12-23-21(30)31/h18,22-23H,3-16H2,1-2H3,(H,24,26)(H,28,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | JXKSHLQLVNIABU-SFHVURJKSA-N |
| XLogP | 2.73 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|