C9H13NO6S — CID 20849151
4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-oxobutanoic acid (PubChem CID 20849151) has the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-oxobutanoic acid.
| Compound Name | 4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-oxobutanoic acid |
|---|---|
| PubChem CID | 20849151 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-2-oxobutanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO6S/c1-5(11)10-6(8(13)14)4-17-3-2-7(12)9(15)16/h6H,2-4H2,1H3,(H,10,11)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | AHFWWWFNCBRMIV-LURJTMIESA-N |
| XLogP | -0.65 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|