C9H18N2O3S — CID 107774722
(2R)-2-acetamido-3-[2-(dimethylamino)ethylsulfanyl]propanoic acid (PubChem CID 107774722) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-(dimethylamino)ethylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-(dimethylamino)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107774722 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2R)-2-acetamido-3-[2-(dimethylamino)ethylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCN(C)C)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S/c1-7(12)10-8(9(13)14)6-15-5-4-11(2)3/h8H,4-6H2,1-3H3,(H,10,12)(H,13,14)/t8-/m0/s1 |
| InChIKey | JUWVOICKJVEAFO-QMMMGPOBSA-N |
| XLogP | -0.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|