C8H15NO5S2 — CID 107774368
(2R)-2-acetamido-3-(2-methylsulfonylethylsulfanyl)propanoic acid (PubChem CID 107774368) has the molecular formula C8H15NO5S2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(2-methylsulfonylethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(2-methylsulfonylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 107774368 |
| Molecular Formula | C8H15NO5S2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (2R)-2-acetamido-3-(2-methylsulfonylethylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H15NO5S2/c1-6(10)9-7(8(11)12)5-15-3-4-16(2,13)14/h7H,3-5H2,1-2H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
| InChIKey | YYPYNZUKUYAWCE-ZETCQYMHSA-N |
| XLogP | -0.65 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|