C10H19NO5S2 — CID 107774310
(2R)-2-acetamido-3-(2-propan-2-ylsulfonylethylsulfanyl)propanoic acid (PubChem CID 107774310) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(2-propan-2-ylsulfonylethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(2-propan-2-ylsulfonylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 107774310 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2R)-2-acetamido-3-(2-propan-2-ylsulfonylethylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCS(=O)(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C10H19NO5S2/c1-7(2)18(15,16)5-4-17-6-9(10(13)14)11-8(3)12/h7,9H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t9-/m0/s1 |
| InChIKey | SOMGFTXJGFDMMO-VIFPVBQESA-N |
| XLogP | 0.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|