About 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate
2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate (PubChem CID 76518973) has the molecular formula C8H19NO6S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate.
Molecular Properties
| Compound Name | 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate |
| PubChem CID | 76518973 |
| Molecular Formula | C8H19NO6S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate |
| SMILES | CC(=O)NC(CSCC(C)O)C(=O)O.O.O |
| InChI | InChI=1S/C8H15NO4S.2H2O/c1-5(10)3-14-4-7(8(12)13)9-6(2)11;;/h5,7,10H,3-4H2,1-2H3,(H,9,11)(H,12,13);2*1H2 |
| InChIKey | IBLFCSKITPAWBF-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate?
The IUPAC name of 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate (CID 76518973) is 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate.
What is the SMILES notation for 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate?
The canonical SMILES for 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate is CC(=O)NC(CSCC(C)O)C(=O)O.O.O.
What is the InChIKey of 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate?
The InChIKey is IBLFCSKITPAWBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S.2H2O/c1-5(10)3-14-4-7(8(12)13)9-6(2)11;;/h5,7,10H,3-4H2,1-2H3,(H,9,11)(H,12,13);2*1H2.
What are the key properties of 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate?
2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate has a molecular weight of 257.31 g/mol, XLogP of -1.96, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(2-hydroxypropylsulfanyl)propanoic acid;dihydrate is sourced from PubChem (CID 76518973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).