C8H12N2O4S — CID 102576820
(2R)-2-acetamido-3-(2-cyano-1,1,2-trideuterio-2-hydroxyethyl)sulfanylpropanoic acid (PubChem CID 102576820) has the molecular formula C8H12N2O4S and a molecular weight of 235.28 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(2-cyano-1,1,2-trideuterio-2-hydroxyethyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-(2-cyano-1,1,2-trideuterio-2-hydroxyethyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 102576820 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (2R)-2-acetamido-3-(2-cyano-1,1,2-trideuterio-2-hydroxyethyl)sulfanylpropanoic acid |
| SMILES | [2H]C(O)(C#N)C([2H])([2H])SC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C8H12N2O4S/c1-5(11)10-7(8(13)14)4-15-3-6(12)2-9/h6-7,12H,3-4H2,1H3,(H,10,11)(H,13,14)/t6?,7-/m0/s1/i3D2,6D |
| InChIKey | SOJIBDFTYPGKGH-UKTUPLSWSA-N |
| XLogP | -0.81 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|