C9H17NO5S — CID 71312869
(2S)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid (PubChem CID 71312869) has the molecular formula C9H17NO5S and a molecular weight of 258.35 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71312869 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S)-2-acetamido-3-(1,1,2,2,3,4,4-heptadeuterio-3,4-dihydroxybutyl)sulfanylpropanoic acid |
| SMILES | [2H]C([2H])(O)C([2H])(O)C([2H])([2H])C([2H])([2H])SC[C@@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H17NO5S/c1-6(12)10-8(9(14)15)5-16-3-2-7(13)4-11/h7-8,11,13H,2-5H2,1H3,(H,10,12)(H,14,15)/t7?,8-/m1/s1/i2D2,3D2,4D2,7D |
| InChIKey | VGJNEDFZFZCLSX-ZUVKEVAGSA-N |
| XLogP | -0.95 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |