C8H15NO4S — CID 40642510
(2S)-2-acetamido-3-[(2S)-2-hydroxypropyl]sulfanylpropanoic acid (PubChem CID 40642510) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(2S)-2-hydroxypropyl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-[(2S)-2-hydroxypropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 40642510 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2S)-2-acetamido-3-[(2S)-2-hydroxypropyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CSC[C@H](C)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-5(10)3-14-4-7(8(12)13)9-6(2)11/h5,7,10H,3-4H2,1-2H3,(H,9,11)(H,12,13)/t5-,7+/m0/s1 |
| InChIKey | FGOZBZPHEMIBIQ-CAHLUQPWSA-N |
| XLogP | -0.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |