C5H9NO4S — CID 177062913
(2S)-2-acetamido-3-hydroxysulfanylpropanoic acid (PubChem CID 177062913) has the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. Its IUPAC name is (2S)-2-acetamido-3-hydroxysulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-hydroxysulfanylpropanoic acid |
|---|---|
| PubChem CID | 177062913 |
| Molecular Formula | C5H9NO4S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (2S)-2-acetamido-3-hydroxysulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CSO)C(=O)O |
| InChI | InChI=1S/C5H9NO4S/c1-3(7)6-4(2-11-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m1/s1 |
| InChIKey | UDRNLIPAONYIBJ-SCSAIBSYSA-N |
| XLogP | -0.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|