C14H18N2O8S2 — CID 129026297
(2R)-2-acetamido-3-[(E)-4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-4-oxobut-2-enoyl]sulfanylpropanoic acid (PubChem CID 129026297) has the molecular formula C14H18N2O8S2 and a molecular weight of 406.44 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(E)-4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-4-oxobut-2-enoyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(E)-4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-4-oxobut-2-enoyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 129026297 |
| Molecular Formula | C14H18N2O8S2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (2R)-2-acetamido-3-[(E)-4-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-4-oxobut-2-enoyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)/C=C/C(=O)SC[C@H](NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O8S2/c1-7(17)15-9(13(21)22)5-25-11(19)3-4-12(20)26-6-10(14(23)24)16-8(2)18/h3-4,9-10H,5-6H2,1-2H3,(H,15,17)(H,16,18)(H,21,22)(H,23,24)/b4-3+/t9-,10-/m0/s1 |
| InChIKey | QSINNFMRGZRHAY-OHINUGQQSA-N |
| XLogP | -0.76 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|