C7H9Cl2NO3S — CID 71333289
2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid (PubChem CID 71333289) has the molecular formula C7H9Cl2NO3S and a molecular weight of 258.13 g/mol. Its IUPAC name is 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 71333289 |
| Molecular Formula | C7H9Cl2NO3S |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid |
| SMILES | CC(=O)NC(CSC(Cl)=CCl)C(=O)O |
| InChI | InChI=1S/C7H9Cl2NO3S/c1-4(11)10-5(7(12)13)3-14-6(9)2-8/h2,5H,3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | LPPJGTSPIBSYQO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |