2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid

C7H9Cl2NO3S — CID 71333289

IUPAC2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid
SMILESCC(=O)NC(CSC(Cl)=CCl)C(=O)O
InChIInChI=1S/C7H9Cl2NO3S/c1-4(11)10-5(7(12)13)3-14-6(9)2-8/h2,5H,3H2,1H3,(H,10,11)(H,12,13)
InChIKeyLPPJGTSPIBSYQO-UHFFFAOYSA-N
MW258.13 g/mol
LogP1.59
Rot. Bonds5

About 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid

2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid (PubChem CID 71333289) has the molecular formula C7H9Cl2NO3S and a molecular weight of 258.13 g/mol. Its IUPAC name is 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid
PubChem CID71333289
Molecular FormulaC7H9Cl2NO3S
Molecular Weight258.13 g/mol
Exact Mass256.97
IUPAC Name2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid
SMILESCC(=O)NC(CSC(Cl)=CCl)C(=O)O
InChIInChI=1S/C7H9Cl2NO3S/c1-4(11)10-5(7(12)13)3-14-6(9)2-8/h2,5H,3H2,1H3,(H,10,11)(H,12,13)
InChIKeyLPPJGTSPIBSYQO-UHFFFAOYSA-N
XLogP1.59
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.13
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid?
The IUPAC name of 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid (CID 71333289) is 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid?
The canonical SMILES for 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid is CC(=O)NC(CSC(Cl)=CCl)C(=O)O.
What is the InChIKey of 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid?
The InChIKey is LPPJGTSPIBSYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2NO3S/c1-4(11)10-5(7(12)13)3-14-6(9)2-8/h2,5H,3H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid?
2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid has a molecular weight of 258.13 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(1,2-dichloroethenylsulfanyl)propanoic acid is sourced from PubChem (CID 71333289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).