C10H16N2O8S2 — CID 57304423
(2R)-2-acetamido-3-[(2S)-2-acetamido-3-sulfopropanoyl]sulfanylpropanoic acid (PubChem CID 57304423) has the molecular formula C10H16N2O8S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2S)-2-acetamido-3-sulfopropanoyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(2S)-2-acetamido-3-sulfopropanoyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57304423 |
| Molecular Formula | C10H16N2O8S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (2R)-2-acetamido-3-[(2S)-2-acetamido-3-sulfopropanoyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)[C@H](CS(=O)(=O)O)NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H16N2O8S2/c1-5(13)11-7(9(15)16)3-21-10(17)8(12-6(2)14)4-22(18,19)20/h7-8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)(H,18,19,20)/t7-,8-/m0/s1 |
| InChIKey | RXRZKQOYGKZBSZ-YUMQZZPRSA-N |
| XLogP | -1.77 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|