C5H10NNaO6S — CID 173222735
sodium;(2S)-2-acetamido-3-sulfopropanoic acid;hydride (PubChem CID 173222735) has the molecular formula C5H10NNaO6S and a molecular weight of 235.19 g/mol. Its IUPAC name is sodium;(2S)-2-acetamido-3-sulfopropanoic acid;hydride.
| Compound Name | sodium;(2S)-2-acetamido-3-sulfopropanoic acid;hydride |
|---|---|
| PubChem CID | 173222735 |
| Molecular Formula | C5H10NNaO6S |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | sodium;(2S)-2-acetamido-3-sulfopropanoic acid;hydride |
| SMILES | CC(=O)N[C@H](CS(=O)(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H9NO6S.Na.H/c1-3(7)6-4(5(8)9)2-13(10,11)12;;/h4H,2H2,1H3,(H,6,7)(H,8,9)(H,10,11,12);;/q;+1;-1/t4-;;/m1../s1 |
| InChIKey | WDTRACUFFABQJE-RZFWHQLPSA-N |
| XLogP | -4.42 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|