C6H8F3NO5S — CID 107774950
(2R)-2-acetamido-3-(trifluoromethylsulfonyl)propanoic acid (PubChem CID 107774950) has the molecular formula C6H8F3NO5S and a molecular weight of 263.19 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(trifluoromethylsulfonyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(trifluoromethylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 107774950 |
| Molecular Formula | C6H8F3NO5S |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | (2R)-2-acetamido-3-(trifluoromethylsulfonyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H8F3NO5S/c1-3(11)10-4(5(12)13)2-16(14,15)6(7,8)9/h4H,2H2,1H3,(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | FVESCHOCMYWBJS-BYPYZUCNSA-N |
| XLogP | -0.49 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |