C9H14F3NO6S — CID 107768132
2-acetamido-3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]propanoic acid (PubChem CID 107768132) has the molecular formula C9H14F3NO6S and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-acetamido-3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]propanoic acid.
| Compound Name | 2-acetamido-3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 107768132 |
| Molecular Formula | C9H14F3NO6S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-acetamido-3-[2-(2,2,2-trifluoroethoxy)ethylsulfonyl]propanoic acid |
| SMILES | CC(=O)NC(CS(=O)(=O)CCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H14F3NO6S/c1-6(14)13-7(8(15)16)4-20(17,18)3-2-19-5-9(10,11)12/h7H,2-5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FYZRAYFOBZAVKX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|