C8H12F3NO5 — CID 61152760
(2S)-3-hydroxy-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanoic acid (PubChem CID 61152760) has the molecular formula C8H12F3NO5 and a molecular weight of 259.18 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 61152760 |
| Molecular Formula | C8H12F3NO5 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (2S)-3-hydroxy-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]propanoic acid |
| SMILES | O=C(CCOCC(F)(F)F)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H12F3NO5/c9-8(10,11)4-17-2-1-6(14)12-5(3-13)7(15)16/h5,13H,1-4H2,(H,12,14)(H,15,16)/t5-/m0/s1 |
| InChIKey | QDBYIBAFRORERJ-YFKPBYRVSA-N |
| XLogP | -0.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|