C8H13F2NO5 — CID 103206146
(2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-3-hydroxypropanoic acid (PubChem CID 103206146) has the molecular formula C8H13F2NO5 and a molecular weight of 241.19 g/mol. Its IUPAC name is (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 103206146 |
| Molecular Formula | C8H13F2NO5 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (2R)-2-[3-(2,2-difluoroethoxy)propanoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(CCOCC(F)F)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C8H13F2NO5/c9-6(10)4-16-2-1-7(13)11-5(3-12)8(14)15/h5-6,12H,1-4H2,(H,11,13)(H,14,15)/t5-/m1/s1 |
| InChIKey | OOIZFPYBLHGECT-RXMQYKEDSA-N |
| XLogP | -0.78 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|