C8H15NO5 — CID 80750602
(2R)-2-(3-ethoxypropanoylamino)-3-hydroxypropanoic acid (PubChem CID 80750602) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (2R)-2-(3-ethoxypropanoylamino)-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-(3-ethoxypropanoylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80750602 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (2R)-2-(3-ethoxypropanoylamino)-3-hydroxypropanoic acid |
| SMILES | CCOCCC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C8H15NO5/c1-2-14-4-3-7(11)9-6(5-10)8(12)13/h6,10H,2-5H2,1H3,(H,9,11)(H,12,13)/t6-/m1/s1 |
| InChIKey | NCMBBWQOGKHCAN-ZCFIWIBFSA-N |
| XLogP | -1.03 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|