C10H19F2NO4 — CID 103525153
3-(2,2-difluoroethoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide (PubChem CID 103525153) has the molecular formula C10H19F2NO4 and a molecular weight of 255.26 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide |
|---|---|
| PubChem CID | 103525153 |
| Molecular Formula | C10H19F2NO4 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)propanamide |
| SMILES | COCC(CCO)NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H19F2NO4/c1-16-6-8(2-4-14)13-10(15)3-5-17-7-9(11)12/h8-9,14H,2-7H2,1H3,(H,13,15) |
| InChIKey | VRMUXBIDTKIBLI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|