C10H19F3N2O3 — CID 114150665
N-(4-amino-1-methoxybutan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 114150665) has the molecular formula C10H19F3N2O3 and a molecular weight of 272.27 g/mol. Its IUPAC name is N-(4-amino-1-methoxybutan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(4-amino-1-methoxybutan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 114150665 |
| Molecular Formula | C10H19F3N2O3 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(4-amino-1-methoxybutan-2-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | COCC(CCN)NC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O3/c1-17-6-8(2-4-14)15-9(16)3-5-18-7-10(11,12)13/h8H,2-7,14H2,1H3,(H,15,16) |
| InChIKey | JFGQPGHALNBRRG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|