C10H15F3N2O5 — CID 61144339
(2S)-5-amino-5-oxo-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]pentanoic acid (PubChem CID 61144339) has the molecular formula C10H15F3N2O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 61144339 |
| Molecular Formula | C10H15F3N2O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H15F3N2O5/c11-10(12,13)5-20-4-3-8(17)15-6(9(18)19)1-2-7(14)16/h6H,1-5H2,(H2,14,16)(H,15,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | HMLWMZXOYWRDJG-LURJTMIESA-N |
| XLogP | -0.21 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|