C9H18F2N2O2 — CID 103205439
N-(4-aminobutan-2-yl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103205439) has the molecular formula C9H18F2N2O2 and a molecular weight of 224.25 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(4-aminobutan-2-yl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103205439 |
| Molecular Formula | C9H18F2N2O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(4-aminobutan-2-yl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | CC(CCN)NC(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H18F2N2O2/c1-7(2-4-12)13-9(14)3-5-15-6-8(10)11/h7-8H,2-6,12H2,1H3,(H,13,14) |
| InChIKey | ZIKVZJVVHMTLTM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|