C10H20F2N2O2 — CID 103205484
N-(5-aminopentyl)-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103205484) has the molecular formula C10H20F2N2O2 and a molecular weight of 238.28 g/mol. Its IUPAC name is N-(5-aminopentyl)-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(5-aminopentyl)-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103205484 |
| Molecular Formula | C10H20F2N2O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(5-aminopentyl)-3-(2,2-difluoroethoxy)propanamide |
| SMILES | NCCCCCNC(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H20F2N2O2/c11-9(12)8-16-7-4-10(15)14-6-3-1-2-5-13/h9H,1-8,13H2,(H,14,15) |
| InChIKey | FBSIJUUWLOZXHM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|