C8H17F2NO — CID 82006295
6-(2,2-difluoroethoxy)hexan-1-amine (PubChem CID 82006295) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)hexan-1-amine.
| Compound Name | 6-(2,2-difluoroethoxy)hexan-1-amine |
|---|---|
| PubChem CID | 82006295 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-(2,2-difluoroethoxy)hexan-1-amine |
| SMILES | NCCCCCCOCC(F)F |
| InChI | InChI=1S/C8H17F2NO/c9-8(10)7-12-6-4-2-1-3-5-11/h8H,1-7,11H2 |
| InChIKey | MIGVHHQPPKNLFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|