C6H12F2OS — CID 82010283
4-(2,2-difluoroethoxy)butane-1-thiol (PubChem CID 82010283) has the molecular formula C6H12F2OS and a molecular weight of 170.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)butane-1-thiol.
| Compound Name | 4-(2,2-difluoroethoxy)butane-1-thiol |
|---|---|
| PubChem CID | 82010283 |
| Molecular Formula | C6H12F2OS |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-(2,2-difluoroethoxy)butane-1-thiol |
| SMILES | FC(F)COCCCCS |
| InChI | InChI=1S/C6H12F2OS/c7-6(8)5-9-3-1-2-4-10/h6,10H,1-5H2 |
| InChIKey | DDJZNZRDUSOXPA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|