C5H12ClF2NO — CID 71756154
3-(2,2-difluoroethoxy)propan-1-amine;hydrochloride (PubChem CID 71756154) has the molecular formula C5H12ClF2NO and a molecular weight of 175.61 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)propan-1-amine;hydrochloride.
| Compound Name | 3-(2,2-difluoroethoxy)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 71756154 |
| Molecular Formula | C5H12ClF2NO |
| Molecular Weight | 175.61 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-(2,2-difluoroethoxy)propan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOCC(F)F |
| InChI | InChI=1S/C5H11F2NO.ClH/c6-5(7)4-9-3-1-2-8;/h5H,1-4,8H2;1H |
| InChIKey | XXJFQLLJTLLJDH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|