C8H18F2N2O — CID 103208190
(2S)-2-N-[3-(2,2-difluoroethoxy)propyl]propane-1,2-diamine (PubChem CID 103208190) has the molecular formula C8H18F2N2O and a molecular weight of 196.24 g/mol. Its IUPAC name is (2S)-2-N-[3-(2,2-difluoroethoxy)propyl]propane-1,2-diamine.
| Compound Name | (2S)-2-N-[3-(2,2-difluoroethoxy)propyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 103208190 |
| Molecular Formula | C8H18F2N2O |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (2S)-2-N-[3-(2,2-difluoroethoxy)propyl]propane-1,2-diamine |
| SMILES | C[C@@H](CN)NCCCOCC(F)F |
| InChI | InChI=1S/C8H18F2N2O/c1-7(5-11)12-3-2-4-13-6-8(9)10/h7-8,12H,2-6,11H2,1H3/t7-/m0/s1 |
| InChIKey | XRFVJRCFFHCEER-ZETCQYMHSA-N |
| XLogP | 0.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|