C10H24N2O — CID 103389691
2-N-[2-(3-methylbutoxy)ethyl]propane-1,2-diamine (PubChem CID 103389691) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-N-[2-(3-methylbutoxy)ethyl]propane-1,2-diamine.
| Compound Name | 2-N-[2-(3-methylbutoxy)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 103389691 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 2-N-[2-(3-methylbutoxy)ethyl]propane-1,2-diamine |
| SMILES | CC(C)CCOCCNC(C)CN |
| InChI | InChI=1S/C10H24N2O/c1-9(2)4-6-13-7-5-12-10(3)8-11/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | OJMFEGLEKBVANN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|