C14H25NOS — CID 54956098
N-[2-(3-methylbutoxy)ethyl]-1-thiophen-3-ylpropan-2-amine (PubChem CID 54956098) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is N-[2-(3-methylbutoxy)ethyl]-1-thiophen-3-ylpropan-2-amine.
| Compound Name | N-[2-(3-methylbutoxy)ethyl]-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 54956098 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-[2-(3-methylbutoxy)ethyl]-1-thiophen-3-ylpropan-2-amine |
| SMILES | CC(C)CCOCCNC(C)Cc1ccsc1 |
| InChI | InChI=1S/C14H25NOS/c1-12(2)4-7-16-8-6-15-13(3)10-14-5-9-17-11-14/h5,9,11-13,15H,4,6-8,10H2,1-3H3 |
| InChIKey | MDIYHSUPKFHUIS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|