C9H14FNS — CID 80694035
N-(2-fluoroethyl)-1-thiophen-3-ylpropan-2-amine (PubChem CID 80694035) has the molecular formula C9H14FNS and a molecular weight of 187.28 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-thiophen-3-ylpropan-2-amine.
| Compound Name | N-(2-fluoroethyl)-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 80694035 |
| Molecular Formula | C9H14FNS |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-(2-fluoroethyl)-1-thiophen-3-ylpropan-2-amine |
| SMILES | CC(Cc1ccsc1)NCCF |
| InChI | InChI=1S/C9H14FNS/c1-8(11-4-3-10)6-9-2-5-12-7-9/h2,5,7-8,11H,3-4,6H2,1H3 |
| InChIKey | HVVGLWCFAMNJPB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |