C12H18F3NOS — CID 54961663
1-thiophen-3-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-2-amine (PubChem CID 54961663) has the molecular formula C12H18F3NOS and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-thiophen-3-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-2-amine.
| Compound Name | 1-thiophen-3-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-2-amine |
|---|---|
| PubChem CID | 54961663 |
| Molecular Formula | C12H18F3NOS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-thiophen-3-yl-N-[3-(2,2,2-trifluoroethoxy)propyl]propan-2-amine |
| SMILES | CC(Cc1ccsc1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NOS/c1-10(7-11-3-6-18-8-11)16-4-2-5-17-9-12(13,14)15/h3,6,8,10,16H,2,4-5,7,9H2,1H3 |
| InChIKey | RLJFFAVMWQWHBI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|