C14H20N2S2 — CID 75427876
N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1-thiophen-3-ylpropan-2-amine (PubChem CID 75427876) has the molecular formula C14H20N2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1-thiophen-3-ylpropan-2-amine.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 75427876 |
| Molecular Formula | C14H20N2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-1-thiophen-3-ylpropan-2-amine |
| SMILES | Cc1csc(CCCNC(C)Cc2ccsc2)n1 |
| InChI | InChI=1S/C14H20N2S2/c1-11(8-13-5-7-17-10-13)15-6-3-4-14-16-12(2)9-18-14/h5,7,9-11,15H,3-4,6,8H2,1-2H3 |
| InChIKey | AASCVQQCAHGBDM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|