C8H18F2N2O — CID 103208149
N'-[3-(2,2-difluoroethoxy)propyl]propane-1,3-diamine (PubChem CID 103208149) has the molecular formula C8H18F2N2O and a molecular weight of 196.24 g/mol. Its IUPAC name is N'-[3-(2,2-difluoroethoxy)propyl]propane-1,3-diamine.
| Compound Name | N'-[3-(2,2-difluoroethoxy)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103208149 |
| Molecular Formula | C8H18F2N2O |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | N'-[3-(2,2-difluoroethoxy)propyl]propane-1,3-diamine |
| SMILES | NCCCNCCCOCC(F)F |
| InChI | InChI=1S/C8H18F2N2O/c9-8(10)7-13-6-2-5-12-4-1-3-11/h8,12H,1-7,11H2 |
| InChIKey | GNAXCSRQQZUVET-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|