C13H25F2NO2 — CID 114191152
N-[2-(2,2-difluoroethoxy)ethyl]-4-(oxan-4-yl)butan-1-amine (PubChem CID 114191152) has the molecular formula C13H25F2NO2 and a molecular weight of 265.34 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-(oxan-4-yl)butan-1-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(oxan-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 114191152 |
| Molecular Formula | C13H25F2NO2 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(oxan-4-yl)butan-1-amine |
| SMILES | FC(F)COCCNCCCCC1CCOCC1 |
| InChI | InChI=1S/C13H25F2NO2/c14-13(15)11-18-10-7-16-6-2-1-3-12-4-8-17-9-5-12/h12-13,16H,1-11H2 |
| InChIKey | ZEXYTHYAAPDLLU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|