C11H21F2NO2 — CID 103083062
N-[2-(2,2-difluoroethoxy)ethyl]-3-(oxolan-2-yl)propan-1-amine (PubChem CID 103083062) has the molecular formula C11H21F2NO2 and a molecular weight of 237.29 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-(oxolan-2-yl)propan-1-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(oxolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 103083062 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(oxolan-2-yl)propan-1-amine |
| SMILES | FC(F)COCCNCCCC1CCCO1 |
| InChI | InChI=1S/C11H21F2NO2/c12-11(13)9-15-8-6-14-5-1-3-10-4-2-7-16-10/h10-11,14H,1-9H2 |
| InChIKey | HJSIYQLPAOMQEW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|