C12H17F2NO — CID 114782953
N-benzyl-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 114782953) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is N-benzyl-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | N-benzyl-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 114782953 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-benzyl-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | FC(F)COCCCNCc1ccccc1 |
| InChI | InChI=1S/C12H17F2NO/c13-12(14)10-16-8-4-7-15-9-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2 |
| InChIKey | BHIWSXSOXIBXAG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|