C12H14F5NO — CID 75529792
N-benzyl-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine (PubChem CID 75529792) has the molecular formula C12H14F5NO and a molecular weight of 283.24 g/mol. Its IUPAC name is N-benzyl-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine.
| Compound Name | N-benzyl-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 75529792 |
| Molecular Formula | C12H14F5NO |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-benzyl-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine |
| SMILES | FC(F)(F)C(F)(F)OCCCNCc1ccccc1 |
| InChI | InChI=1S/C12H14F5NO/c13-11(14,15)12(16,17)19-8-4-7-18-9-10-5-2-1-3-6-10/h1-3,5-6,18H,4,7-9H2 |
| InChIKey | RNSKQBIIWXSDHA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|