C12H13ClF5NO — CID 75529948
N-[(4-chlorophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine (PubChem CID 75529948) has the molecular formula C12H13ClF5NO and a molecular weight of 317.69 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 75529948 |
| Molecular Formula | C12H13ClF5NO |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethoxy)propan-1-amine |
| SMILES | FC(F)(F)C(F)(F)OCCCNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClF5NO/c13-10-4-2-9(3-5-10)8-19-6-1-7-20-12(17,18)11(14,15)16/h2-5,19H,1,6-8H2 |
| InChIKey | WDFWFZLURQPUHW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|