C18H22Cl2N2 — CID 131985015
N,N'-bis[(4-chlorophenyl)methyl]butane-1,4-diamine (PubChem CID 131985015) has the molecular formula C18H22Cl2N2 and a molecular weight of 337.29 g/mol. Its IUPAC name is N,N'-bis[(4-chlorophenyl)methyl]butane-1,4-diamine.
| Compound Name | N,N'-bis[(4-chlorophenyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 131985015 |
| Molecular Formula | C18H22Cl2N2 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N,N'-bis[(4-chlorophenyl)methyl]butane-1,4-diamine |
| SMILES | Clc1ccc(CNCCCCNCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H22Cl2N2/c19-17-7-3-15(4-8-17)13-21-11-1-2-12-22-14-16-5-9-18(20)10-6-16/h3-10,21-22H,1-2,11-14H2 |
| InChIKey | HCTOCMSGHOCFQA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|