C12H19ClN2 — CID 17215378
N'-[(4-chlorophenyl)methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215378) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215378 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H19ClN2/c1-2-14-8-3-9-15-10-11-4-6-12(13)7-5-11/h4-7,14-15H,2-3,8-10H2,1H3 |
| InChIKey | PGRVVZXHWUUIJE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|