C12H22F4O5 — CID 170162541
2-[2-[2-[2-[2-(2,2-difluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-1,1-difluoroethane (PubChem CID 170162541) has the molecular formula C12H22F4O5 and a molecular weight of 322.30 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2,2-difluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-1,1-difluoroethane.
| Compound Name | 2-[2-[2-[2-[2-(2,2-difluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-1,1-difluoroethane |
|---|---|
| PubChem CID | 170162541 |
| Molecular Formula | C12H22F4O5 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[2-[2-[2-[2-(2,2-difluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-1,1-difluoroethane |
| SMILES | FC(F)COCCOCCOCCOCCOCC(F)F |
| InChI | InChI=1S/C12H22F4O5/c13-11(14)9-20-7-5-18-3-1-17-2-4-19-6-8-21-10-12(15)16/h11-12H,1-10H2 |
| InChIKey | RMYBVROBJWXVQW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|