C6H10F4O3 — CID 172816693
2-(2,2-difluoroethoxymethoxymethoxy)-1,1-difluoroethane (PubChem CID 172816693) has the molecular formula C6H10F4O3 and a molecular weight of 206.13 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxymethoxymethoxy)-1,1-difluoroethane.
| Compound Name | 2-(2,2-difluoroethoxymethoxymethoxy)-1,1-difluoroethane |
|---|---|
| PubChem CID | 172816693 |
| Molecular Formula | C6H10F4O3 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-(2,2-difluoroethoxymethoxymethoxy)-1,1-difluoroethane |
| SMILES | FC(F)COCOCOCC(F)F |
| InChI | InChI=1S/C6H10F4O3/c7-5(8)1-11-3-13-4-12-2-6(9)10/h5-6H,1-4H2 |
| InChIKey | SXBZLEBUXKKGBT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|