C6H12F2N2O — CID 82004482
4-(2,2-difluoroethoxy)butanimidamide (PubChem CID 82004482) has the molecular formula C6H12F2N2O and a molecular weight of 166.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)butanimidamide.
| Compound Name | 4-(2,2-difluoroethoxy)butanimidamide |
|---|---|
| PubChem CID | 82004482 |
| Molecular Formula | C6H12F2N2O |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4-(2,2-difluoroethoxy)butanimidamide |
| SMILES | [H]/N=C(\N)CCCOCC(F)F |
| InChI | InChI=1S/C6H12F2N2O/c7-5(8)4-11-3-1-2-6(9)10/h5H,1-4H2,(H3,9,10) |
| InChIKey | QEKFGXJEXADNKU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|