C7H14F2N2O2 — CID 82009779
5-(2,2-difluoroethoxy)pentanehydrazide (PubChem CID 82009779) has the molecular formula C7H14F2N2O2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pentanehydrazide.
| Compound Name | 5-(2,2-difluoroethoxy)pentanehydrazide |
|---|---|
| PubChem CID | 82009779 |
| Molecular Formula | C7H14F2N2O2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-(2,2-difluoroethoxy)pentanehydrazide |
| SMILES | NNC(=O)CCCCOCC(F)F |
| InChI | InChI=1S/C7H14F2N2O2/c8-6(9)5-13-4-2-1-3-7(12)11-10/h6H,1-5,10H2,(H,11,12) |
| InChIKey | LHNDPAPIFMLJDG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|