C8H12F6N2O2 — CID 102723432
5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanehydrazide (PubChem CID 102723432) has the molecular formula C8H12F6N2O2 and a molecular weight of 282.18 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanehydrazide.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanehydrazide |
|---|---|
| PubChem CID | 102723432 |
| Molecular Formula | C8H12F6N2O2 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanehydrazide |
| SMILES | NNC(=O)CCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6N2O2/c9-7(10,11)6(8(12,13)14)18-4-2-1-3-5(17)16-15/h6H,1-4,15H2,(H,16,17) |
| InChIKey | OQIARYXHUKGBJK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|