C6H6F6O3 — CID 102685236
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanoic acid (PubChem CID 102685236) has the molecular formula C6H6F6O3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanoic acid.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanoic acid |
|---|---|
| PubChem CID | 102685236 |
| Molecular Formula | C6H6F6O3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propanoic acid |
| SMILES | O=C(O)CCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O3/c7-5(8,9)4(6(10,11)12)15-2-1-3(13)14/h4H,1-2H2,(H,13,14) |
| InChIKey | BURPADNRJRIMNW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |