C10H15F6NO3 — CID 106807179
2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanoic acid (PubChem CID 106807179) has the molecular formula C10H15F6NO3 and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanoic acid.
| Compound Name | 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanoic acid |
|---|---|
| PubChem CID | 106807179 |
| Molecular Formula | C10H15F6NO3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-amino-2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentanoic acid |
| SMILES | CCC(N)(CCCOC(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H15F6NO3/c1-2-8(17,7(18)19)4-3-5-20-6(9(11,12)13)10(14,15)16/h6H,2-5,17H2,1H3,(H,18,19) |
| InChIKey | MYZJYHINNGQSPV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|